C11H18O2 — CID 89069306
(4Z)-5-methoxy-2,2,6-trimethylhepta-4,6-dien-3-one (PubChem CID 89069306) has the molecular formula C11H18O2 and a molecular weight of 182.26 g/mol. Its IUPAC name is (4Z)-5-methoxy-2,2,6-trimethylhepta-4,6-dien-3-one.
| Compound Name | (4Z)-5-methoxy-2,2,6-trimethylhepta-4,6-dien-3-one |
|---|---|
| PubChem CID | 89069306 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | (4Z)-5-methoxy-2,2,6-trimethylhepta-4,6-dien-3-one |
| SMILES | C=C(C)/C(=C/C(=O)C(C)(C)C)OC |
| InChI | InChI=1S/C11H18O2/c1-8(2)9(13-6)7-10(12)11(3,4)5/h7H,1H2,2-6H3/b9-7- |
| InChIKey | ZNMXTZYFBIAIMC-CLFYSBASSA-N |
| XLogP | 2.71 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|