C7H10F4N2OS — CID 89069321
2,2,2-trifluoro-N-[[(4R)-3-(fluoromethyl)-1,3-thiazolidin-4-yl]methyl]acetamide (PubChem CID 89069321) has the molecular formula C7H10F4N2OS and a molecular weight of 246.23 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[[(4R)-3-(fluoromethyl)-1,3-thiazolidin-4-yl]methyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[[(4R)-3-(fluoromethyl)-1,3-thiazolidin-4-yl]methyl]acetamide |
|---|---|
| PubChem CID | 89069321 |
| Molecular Formula | C7H10F4N2OS |
| Molecular Weight | 246.23 g/mol |
| Exact Mass | 246.04 |
| IUPAC Name | 2,2,2-trifluoro-N-[[(4R)-3-(fluoromethyl)-1,3-thiazolidin-4-yl]methyl]acetamide |
| SMILES | O=C(NC[C@@H]1CSCN1CF)C(F)(F)F |
| InChI | InChI=1S/C7H10F4N2OS/c8-3-13-4-15-2-5(13)1-12-6(14)7(9,10)11/h5H,1-4H2,(H,12,14)/t5-/m1/s1 |
| InChIKey | FMHRGBOPQMANFP-RXMQYKEDSA-N |
| XLogP | 0.97 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.23 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|