About 4-[[(1R,5S)-3-ethyl-3-bicyclo[3.3.1]nonanyl]amino]butane-2-sulfonic acid
4-[[(1R,5S)-3-ethyl-3-bicyclo[3.3.1]nonanyl]amino]butane-2-sulfonic acid (PubChem CID 89069332) has the molecular formula C15H29NO3S
and a molecular weight of 303.47 g/mol. Its IUPAC name is 4-[[(1R,5S)-3-ethyl-3-bicyclo[3.3.1]nonanyl]amino]butane-2-sulfonic acid.
Molecular Properties
| Compound Name | 4-[[(1R,5S)-3-ethyl-3-bicyclo[3.3.1]nonanyl]amino]butane-2-sulfonic acid |
| PubChem CID | 89069332 |
| Molecular Formula | C15H29NO3S |
| Molecular Weight | 303.47 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | 4-[[(1R,5S)-3-ethyl-3-bicyclo[3.3.1]nonanyl]amino]butane-2-sulfonic acid |
| SMILES | CCC1(NCCC(C)S(=O)(=O)O)C[C@@H]2CCC[C@@H](C2)C1 |
| InChI | InChI=1S/C15H29NO3S/c1-3-15(16-8-7-12(2)20(17,18)19)10-13-5-4-6-14(9-13)11-15/h12-14,16H,3-11H2,1-2H3,(H,17,18,19)/t12?,13-,14+,15? |
| InChIKey | ZDFSMRPVHLNBCL-HFDVOGEKSA-N |
| XLogP | 2.99 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.47 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 4-[[(1R,5S)-3-ethyl-3-bicyclo[3.3.1]nonanyl]amino]butane-2-sulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[(1R,5S)-3-ethyl-3-bicyclo[3.3.1]nonanyl]amino]butane-2-sulfonic acid?
The IUPAC name of 4-[[(1R,5S)-3-ethyl-3-bicyclo[3.3.1]nonanyl]amino]butane-2-sulfonic acid (CID 89069332) is 4-[[(1R,5S)-3-ethyl-3-bicyclo[3.3.1]nonanyl]amino]butane-2-sulfonic acid.
What is the SMILES notation for 4-[[(1R,5S)-3-ethyl-3-bicyclo[3.3.1]nonanyl]amino]butane-2-sulfonic acid?
The canonical SMILES for 4-[[(1R,5S)-3-ethyl-3-bicyclo[3.3.1]nonanyl]amino]butane-2-sulfonic acid is CCC1(NCCC(C)S(=O)(=O)O)C[C@@H]2CCC[C@@H](C2)C1.
What is the InChIKey of 4-[[(1R,5S)-3-ethyl-3-bicyclo[3.3.1]nonanyl]amino]butane-2-sulfonic acid?
The InChIKey is ZDFSMRPVHLNBCL-HFDVOGEKSA-N. The full InChI is InChI=1S/C15H29NO3S/c1-3-15(16-8-7-12(2)20(17,18)19)10-13-5-4-6-14(9-13)11-15/h12-14,16H,3-11H2,1-2H3,(H,17,18,19)/t12?,13-,14+,15?.
What are the key properties of 4-[[(1R,5S)-3-ethyl-3-bicyclo[3.3.1]nonanyl]amino]butane-2-sulfonic acid?
4-[[(1R,5S)-3-ethyl-3-bicyclo[3.3.1]nonanyl]amino]butane-2-sulfonic acid has a molecular weight of 303.47 g/mol, XLogP of 2.99, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[(1R,5S)-3-ethyl-3-bicyclo[3.3.1]nonanyl]amino]butane-2-sulfonic acid is sourced from PubChem (CID 89069332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).