About 5-[[(1S,4S)-2-bicyclo[2.2.1]heptanyl]amino]pentane-1-sulfonic acid
5-[[(1S,4S)-2-bicyclo[2.2.1]heptanyl]amino]pentane-1-sulfonic acid (PubChem CID 89069350) has the molecular formula C12H23NO3S
and a molecular weight of 261.39 g/mol. Its IUPAC name is 5-[[(1S,4S)-2-bicyclo[2.2.1]heptanyl]amino]pentane-1-sulfonic acid.
Molecular Properties
| Compound Name | 5-[[(1S,4S)-2-bicyclo[2.2.1]heptanyl]amino]pentane-1-sulfonic acid |
| PubChem CID | 89069350 |
| Molecular Formula | C12H23NO3S |
| Molecular Weight | 261.39 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | 5-[[(1S,4S)-2-bicyclo[2.2.1]heptanyl]amino]pentane-1-sulfonic acid |
| SMILES | O=S(=O)(O)CCCCCNC1C[C@H]2CC[C@H]1C2 |
| InChI | InChI=1S/C12H23NO3S/c14-17(15,16)7-3-1-2-6-13-12-9-10-4-5-11(12)8-10/h10-13H,1-9H2,(H,14,15,16)/t10-,11-,12?/m0/s1 |
| InChIKey | BCTMZHDAJYWZRK-NDQFZYFBSA-N |
| XLogP | 1.82 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.39 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 5-[[(1S,4S)-2-bicyclo[2.2.1]heptanyl]amino]pentane-1-sulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[(1S,4S)-2-bicyclo[2.2.1]heptanyl]amino]pentane-1-sulfonic acid?
The IUPAC name of 5-[[(1S,4S)-2-bicyclo[2.2.1]heptanyl]amino]pentane-1-sulfonic acid (CID 89069350) is 5-[[(1S,4S)-2-bicyclo[2.2.1]heptanyl]amino]pentane-1-sulfonic acid.
What is the SMILES notation for 5-[[(1S,4S)-2-bicyclo[2.2.1]heptanyl]amino]pentane-1-sulfonic acid?
The canonical SMILES for 5-[[(1S,4S)-2-bicyclo[2.2.1]heptanyl]amino]pentane-1-sulfonic acid is O=S(=O)(O)CCCCCNC1C[C@H]2CC[C@H]1C2.
What is the InChIKey of 5-[[(1S,4S)-2-bicyclo[2.2.1]heptanyl]amino]pentane-1-sulfonic acid?
The InChIKey is BCTMZHDAJYWZRK-NDQFZYFBSA-N. The full InChI is InChI=1S/C12H23NO3S/c14-17(15,16)7-3-1-2-6-13-12-9-10-4-5-11(12)8-10/h10-13H,1-9H2,(H,14,15,16)/t10-,11-,12?/m0/s1.
What are the key properties of 5-[[(1S,4S)-2-bicyclo[2.2.1]heptanyl]amino]pentane-1-sulfonic acid?
5-[[(1S,4S)-2-bicyclo[2.2.1]heptanyl]amino]pentane-1-sulfonic acid has a molecular weight of 261.39 g/mol, XLogP of 1.82, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[(1S,4S)-2-bicyclo[2.2.1]heptanyl]amino]pentane-1-sulfonic acid is sourced from PubChem (CID 89069350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).