C9H12NO2P — CID 89069733
2-ethyl-1,4-dihydro-3,1,2λ5-benzoxazaphosphinine 2-oxide (PubChem CID 89069733) has the molecular formula C9H12NO2P and a molecular weight of 197.17 g/mol. Its IUPAC name is 2-ethyl-1,4-dihydro-3,1,2λ5-benzoxazaphosphinine 2-oxide.
| Compound Name | 2-ethyl-1,4-dihydro-3,1,2λ5-benzoxazaphosphinine 2-oxide |
|---|---|
| PubChem CID | 89069733 |
| Molecular Formula | C9H12NO2P |
| Molecular Weight | 197.17 g/mol |
| Exact Mass | 197.06 |
| IUPAC Name | 2-ethyl-1,4-dihydro-3,1,2λ5-benzoxazaphosphinine 2-oxide |
| SMILES | CCP1(=O)Nc2ccccc2CO1 |
| InChI | InChI=1S/C9H12NO2P/c1-2-13(11)10-9-6-4-3-5-8(9)7-12-13/h3-6H,2,7H2,1H3,(H,10,11) |
| InChIKey | DCNHFMHRAWVPIX-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.17 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|