About 6-methoxy-2-methyl-2,3-dihydrothieno[3,2-b]pyridine
6-methoxy-2-methyl-2,3-dihydrothieno[3,2-b]pyridine (PubChem CID 89069766) has the molecular formula C9H11NOS
and a molecular weight of 181.26 g/mol. Its IUPAC name is 6-methoxy-2-methyl-2,3-dihydrothieno[3,2-b]pyridine.
Molecular Properties
| Compound Name | 6-methoxy-2-methyl-2,3-dihydrothieno[3,2-b]pyridine |
| PubChem CID | 89069766 |
| Molecular Formula | C9H11NOS |
| Molecular Weight | 181.26 g/mol |
| Exact Mass | 181.06 |
| IUPAC Name | 6-methoxy-2-methyl-2,3-dihydrothieno[3,2-b]pyridine |
| SMILES | COc1cnc2c(c1)SC(C)C2 |
| InChI | InChI=1S/C9H11NOS/c1-6-3-8-9(12-6)4-7(11-2)5-10-8/h4-6H,3H2,1-2H3 |
| InChIKey | FOBGQOQCCFJMDQ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.26 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-methoxy-2-methyl-2,3-dihydrothieno[3,2-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methoxy-2-methyl-2,3-dihydrothieno[3,2-b]pyridine?
The IUPAC name of 6-methoxy-2-methyl-2,3-dihydrothieno[3,2-b]pyridine (CID 89069766) is 6-methoxy-2-methyl-2,3-dihydrothieno[3,2-b]pyridine.
What is the SMILES notation for 6-methoxy-2-methyl-2,3-dihydrothieno[3,2-b]pyridine?
The canonical SMILES for 6-methoxy-2-methyl-2,3-dihydrothieno[3,2-b]pyridine is COc1cnc2c(c1)SC(C)C2.
What is the InChIKey of 6-methoxy-2-methyl-2,3-dihydrothieno[3,2-b]pyridine?
The InChIKey is FOBGQOQCCFJMDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NOS/c1-6-3-8-9(12-6)4-7(11-2)5-10-8/h4-6H,3H2,1-2H3.
What are the key properties of 6-methoxy-2-methyl-2,3-dihydrothieno[3,2-b]pyridine?
6-methoxy-2-methyl-2,3-dihydrothieno[3,2-b]pyridine has a molecular weight of 181.26 g/mol, XLogP of 2.13, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methoxy-2-methyl-2,3-dihydrothieno[3,2-b]pyridine is sourced from PubChem (CID 89069766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).