C11H16O4 — CID 89070104
(3E,5Z)-4,5,6-trimethoxy-2-methylidenehepta-3,5-dienal (PubChem CID 89070104) has the molecular formula C11H16O4 and a molecular weight of 212.24 g/mol. Its IUPAC name is (3E,5Z)-4,5,6-trimethoxy-2-methylidenehepta-3,5-dienal.
| Compound Name | (3E,5Z)-4,5,6-trimethoxy-2-methylidenehepta-3,5-dienal |
|---|---|
| PubChem CID | 89070104 |
| Molecular Formula | C11H16O4 |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | (3E,5Z)-4,5,6-trimethoxy-2-methylidenehepta-3,5-dienal |
| SMILES | C=C(C=O)/C=C(OC)\C(OC)=C(/C)OC |
| InChI | InChI=1S/C11H16O4/c1-8(7-12)6-10(14-4)11(15-5)9(2)13-3/h6-7H,1H2,2-5H3/b10-6+,11-9- |
| InChIKey | MOUZNDYMBMBKFN-QCOLZXCRSA-N |
| XLogP | 1.80 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.24 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|