C22H20ClFN4 — CID 89070149
N'-[2-(2-chlorophenyl)-6,7,8,9-tetrahydro-5H-cyclohepta[d]pyrimidin-4-yl]-3-fluorobenzenecarboximidamide (PubChem CID 89070149) has the molecular formula C22H20ClFN4 and a molecular weight of 394.88 g/mol. Its IUPAC name is N'-[2-(2-chlorophenyl)-6,7,8,9-tetrahydro-5H-cyclohepta[d]pyrimidin-4-yl]-3-fluorobenzenecarboximidamide.
| Compound Name | N'-[2-(2-chlorophenyl)-6,7,8,9-tetrahydro-5H-cyclohepta[d]pyrimidin-4-yl]-3-fluorobenzenecarboximidamide |
|---|---|
| PubChem CID | 89070149 |
| Molecular Formula | C22H20ClFN4 |
| Molecular Weight | 394.88 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | N'-[2-(2-chlorophenyl)-6,7,8,9-tetrahydro-5H-cyclohepta[d]pyrimidin-4-yl]-3-fluorobenzenecarboximidamide |
| SMILES | N/C(=N\c1nc(-c2ccccc2Cl)nc2c1CCCCC2)c1cccc(F)c1 |
| InChI | InChI=1S/C22H20ClFN4/c23-18-11-5-4-9-16(18)21-26-19-12-3-1-2-10-17(19)22(28-21)27-20(25)14-7-6-8-15(24)13-14/h4-9,11,13H,1-3,10,12H2,(H2,25,26,27,28) |
| InChIKey | ZCZATGWQDSYZSV-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 64.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.88 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|