C26H29N5O — CID 89070215
6-methyl-N-[3-[N-methyl-C-[(1Z)-3-methylbuta-1,3-dienyl]carbonimidoyl]phenyl]-7-pyrrolidin-3-yloxyquinazolin-2-amine (PubChem CID 89070215) has the molecular formula C26H29N5O and a molecular weight of 427.55 g/mol. Its IUPAC name is 6-methyl-N-[3-[N-methyl-C-[(1Z)-3-methylbuta-1,3-dienyl]carbonimidoyl]phenyl]-7-pyrrolidin-3-yloxyquinazolin-2-amine.
| Compound Name | 6-methyl-N-[3-[N-methyl-C-[(1Z)-3-methylbuta-1,3-dienyl]carbonimidoyl]phenyl]-7-pyrrolidin-3-yloxyquinazolin-2-amine |
|---|---|
| PubChem CID | 89070215 |
| Molecular Formula | C26H29N5O |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.24 |
| IUPAC Name | 6-methyl-N-[3-[N-methyl-C-[(1Z)-3-methylbuta-1,3-dienyl]carbonimidoyl]phenyl]-7-pyrrolidin-3-yloxyquinazolin-2-amine |
| SMILES | C=C(C)/C=C\C(=N\C)c1cccc(Nc2ncc3cc(C)c(OC4CCNC4)cc3n2)c1 |
| InChI | InChI=1S/C26H29N5O/c1-17(2)8-9-23(27-4)19-6-5-7-21(13-19)30-26-29-15-20-12-18(3)25(14-24(20)31-26)32-22-10-11-28-16-22/h5-9,12-15,22,28H,1,10-11,16H2,2-4H3,(H,29,30,31)/b9-8-,27-23- |
| InChIKey | NNEVEUFOUFXOMS-QECINTKJSA-N |
| XLogP | 4.97 |
| TPSA | 71.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|