C25H26BF3N6O3 — CID 89070558
CID 89070558 (PubChem CID 89070558) has the molecular formula C25H26BF3N6O3 and a molecular weight of 526.33 g/mol.
| Compound Name | CID 89070558 |
|---|---|
| PubChem CID | 89070558 |
| Molecular Formula | C25H26BF3N6O3 |
| Molecular Weight | 526.33 g/mol |
| Exact Mass | 526.21 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(N)c(Oc2nc(Nc3ccc(C(=O)NC4CCN(C)CC4)cc3OC)ncc2C(F)(F)F)c1 |
| InChI | InChI=1S/C25H26BF3N6O3/c1-35-9-7-16(8-10-35)32-22(36)14-3-6-19(21(11-14)37-2)33-24-31-13-17(25(27,28)29)23(34-24)38-20-12-15(26)4-5-18(20)30/h3-6,11-13,16H,7-10,30H2,1-2H3,(H,32,36)(H,31,33,34) |
| InChIKey | YOXATJFBSBFQEV-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 114.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.33 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|