About 5-tert-butyl-3,3-dimethylazepine
5-tert-butyl-3,3-dimethylazepine (PubChem CID 89070578) has the molecular formula C12H19N
and a molecular weight of 177.29 g/mol. Its IUPAC name is 5-tert-butyl-3,3-dimethylazepine.
Molecular Properties
| Compound Name | 5-tert-butyl-3,3-dimethylazepine |
| PubChem CID | 89070578 |
| Molecular Formula | C12H19N |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 177.15 |
| IUPAC Name | 5-tert-butyl-3,3-dimethylazepine |
| SMILES | CC1(C)C=NC=CC(C(C)(C)C)=C1 |
| InChI | InChI=1S/C12H19N/c1-11(2,3)10-6-7-13-9-12(4,5)8-10/h6-9H,1-5H3 |
| InChIKey | JMXQADUZBIECGI-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-tert-butyl-3,3-dimethylazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-tert-butyl-3,3-dimethylazepine?
The IUPAC name of 5-tert-butyl-3,3-dimethylazepine (CID 89070578) is 5-tert-butyl-3,3-dimethylazepine.
What is the SMILES notation for 5-tert-butyl-3,3-dimethylazepine?
The canonical SMILES for 5-tert-butyl-3,3-dimethylazepine is CC1(C)C=NC=CC(C(C)(C)C)=C1.
What is the InChIKey of 5-tert-butyl-3,3-dimethylazepine?
The InChIKey is JMXQADUZBIECGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N/c1-11(2,3)10-6-7-13-9-12(4,5)8-10/h6-9H,1-5H3.
What are the key properties of 5-tert-butyl-3,3-dimethylazepine?
5-tert-butyl-3,3-dimethylazepine has a molecular weight of 177.29 g/mol, XLogP of 3.58, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-tert-butyl-3,3-dimethylazepine is sourced from PubChem (CID 89070578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).