C11H10IN3O — CID 89070587
3-(3-iodoimidazo[1,2-a]pyridin-7-yl)-5-methyl-4,5-dihydro-1,2-oxazole (PubChem CID 89070587) has the molecular formula C11H10IN3O and a molecular weight of 327.13 g/mol. Its IUPAC name is 3-(3-iodoimidazo[1,2-a]pyridin-7-yl)-5-methyl-4,5-dihydro-1,2-oxazole.
| Compound Name | 3-(3-iodoimidazo[1,2-a]pyridin-7-yl)-5-methyl-4,5-dihydro-1,2-oxazole |
|---|---|
| PubChem CID | 89070587 |
| Molecular Formula | C11H10IN3O |
| Molecular Weight | 327.13 g/mol |
| Exact Mass | 326.99 |
| IUPAC Name | 3-(3-iodoimidazo[1,2-a]pyridin-7-yl)-5-methyl-4,5-dihydro-1,2-oxazole |
| SMILES | CC1CC(c2ccn3c(I)cnc3c2)=NO1 |
| InChI | InChI=1S/C11H10IN3O/c1-7-4-9(14-16-7)8-2-3-15-10(12)6-13-11(15)5-8/h2-3,5-7H,4H2,1H3 |
| InChIKey | XWEFOCZJYDWYQH-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 38.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.13 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|