About 1-[4-(1,1,1-trifluoro-2-methoxypropan-2-yl)phenyl]ethenamine
1-[4-(1,1,1-trifluoro-2-methoxypropan-2-yl)phenyl]ethenamine (PubChem CID 89070699) has the molecular formula C12H14F3NO
and a molecular weight of 245.24 g/mol. Its IUPAC name is 1-[4-(1,1,1-trifluoro-2-methoxypropan-2-yl)phenyl]ethenamine.
Molecular Properties
| Compound Name | 1-[4-(1,1,1-trifluoro-2-methoxypropan-2-yl)phenyl]ethenamine |
| PubChem CID | 89070699 |
| Molecular Formula | C12H14F3NO |
| Molecular Weight | 245.24 g/mol |
| Exact Mass | 245.10 |
| IUPAC Name | 1-[4-(1,1,1-trifluoro-2-methoxypropan-2-yl)phenyl]ethenamine |
| SMILES | C=C(N)c1ccc(C(C)(OC)C(F)(F)F)cc1 |
| InChI | InChI=1S/C12H14F3NO/c1-8(16)9-4-6-10(7-5-9)11(2,17-3)12(13,14)15/h4-7H,1,16H2,2-3H3 |
| InChIKey | NIICDAJWCALCPV-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.24 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[4-(1,1,1-trifluoro-2-methoxypropan-2-yl)phenyl]ethenamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(1,1,1-trifluoro-2-methoxypropan-2-yl)phenyl]ethenamine?
The IUPAC name of 1-[4-(1,1,1-trifluoro-2-methoxypropan-2-yl)phenyl]ethenamine (CID 89070699) is 1-[4-(1,1,1-trifluoro-2-methoxypropan-2-yl)phenyl]ethenamine.
What is the SMILES notation for 1-[4-(1,1,1-trifluoro-2-methoxypropan-2-yl)phenyl]ethenamine?
The canonical SMILES for 1-[4-(1,1,1-trifluoro-2-methoxypropan-2-yl)phenyl]ethenamine is C=C(N)c1ccc(C(C)(OC)C(F)(F)F)cc1.
What is the InChIKey of 1-[4-(1,1,1-trifluoro-2-methoxypropan-2-yl)phenyl]ethenamine?
The InChIKey is NIICDAJWCALCPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14F3NO/c1-8(16)9-4-6-10(7-5-9)11(2,17-3)12(13,14)15/h4-7H,1,16H2,2-3H3.
What are the key properties of 1-[4-(1,1,1-trifluoro-2-methoxypropan-2-yl)phenyl]ethenamine?
1-[4-(1,1,1-trifluoro-2-methoxypropan-2-yl)phenyl]ethenamine has a molecular weight of 245.24 g/mol, XLogP of 3.04, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(1,1,1-trifluoro-2-methoxypropan-2-yl)phenyl]ethenamine is sourced from PubChem (CID 89070699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).