C60H58N2 — CID 89070897
1-[7-[(E)-2-[9,9-dimethyl-7-[4-(2-methyl-3,4-dihydro-2H-quinolin-1-yl)phenyl]-5,6-dihydrofluoren-2-yl]ethenyl]-6,9,9-trimethylfluoren-2-yl]-2,2-dimethylquinoline (PubChem CID 89070897) has the molecular formula C60H58N2 and a molecular weight of 807.14 g/mol. Its IUPAC name is 1-[7-[(E)-2-[9,9-dimethyl-7-[4-(2-methyl-3,4-dihydro-2H-quinolin-1-yl)phenyl]-5,6-dihydrofluoren-2-yl]ethenyl]-6,9,9-trimethylfluoren-2-yl]-2,2-dimethylquinoline.
| Compound Name | 1-[7-[(E)-2-[9,9-dimethyl-7-[4-(2-methyl-3,4-dihydro-2H-quinolin-1-yl)phenyl]-5,6-dihydrofluoren-2-yl]ethenyl]-6,9,9-trimethylfluoren-2-yl]-2,2-dimethylquinoline |
|---|---|
| PubChem CID | 89070897 |
| Molecular Formula | C60H58N2 |
| Molecular Weight | 807.14 g/mol |
| Exact Mass | 806.46 |
| IUPAC Name | 1-[7-[(E)-2-[9,9-dimethyl-7-[4-(2-methyl-3,4-dihydro-2H-quinolin-1-yl)phenyl]-5,6-dihydrofluoren-2-yl]ethenyl]-6,9,9-trimethylfluoren-2-yl]-2,2-dimethylquinoline |
| SMILES | Cc1cc2c(cc1/C=C/c1ccc3c(c1)C(C)(C)C1=C3CCC(c3ccc(N4c5ccccc5CCC4C)cc3)=C1)C(C)(C)c1cc(N3c4ccccc4C=CC3(C)C)ccc1-2 |
| InChI | InChI=1S/C60H58N2/c1-38-33-51-50-30-27-47(62-57-16-12-10-14-43(57)31-32-58(62,3)4)37-55(50)60(7,8)54(51)35-44(38)21-18-40-19-28-48-49-29-24-45(36-53(49)59(5,6)52(48)34-40)41-22-25-46(26-23-41)61-39(2)17-20-42-13-9-11-15-56(42)61/h9-16,18-19,21-23,25-28,30-37,39H,17,20,24,29H2,1-8H3/b21-18+ |
| InChIKey | UDOWDUDCYVJOEG-DYTRJAOYSA-N |
| XLogP | 15.81 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 807.14 |
| LogP ≤ 5 | 15.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|