C63H54N2 — CID 89070905
10-[4-[4-[(E)-2-[7-(9,9-dimethyl-3,4-dihydroacridin-10-yl)-9,9-dimethylfluoren-2-yl]ethenyl]phenyl]naphthalen-1-yl]-9,9-dimethylacridine (PubChem CID 89070905) has the molecular formula C63H54N2 and a molecular weight of 839.14 g/mol. Its IUPAC name is 10-[4-[4-[(E)-2-[7-(9,9-dimethyl-3,4-dihydroacridin-10-yl)-9,9-dimethylfluoren-2-yl]ethenyl]phenyl]naphthalen-1-yl]-9,9-dimethylacridine.
| Compound Name | 10-[4-[4-[(E)-2-[7-(9,9-dimethyl-3,4-dihydroacridin-10-yl)-9,9-dimethylfluoren-2-yl]ethenyl]phenyl]naphthalen-1-yl]-9,9-dimethylacridine |
|---|---|
| PubChem CID | 89070905 |
| Molecular Formula | C63H54N2 |
| Molecular Weight | 839.14 g/mol |
| Exact Mass | 838.43 |
| IUPAC Name | 10-[4-[4-[(E)-2-[7-(9,9-dimethyl-3,4-dihydroacridin-10-yl)-9,9-dimethylfluoren-2-yl]ethenyl]phenyl]naphthalen-1-yl]-9,9-dimethylacridine |
| SMILES | CC1(C)C2=C(CCC=C2)N(c2ccc3c(c2)C(C)(C)c2cc(/C=C/c4ccc(-c5ccc(N6c7ccccc7C(C)(C)c7ccccc76)c6ccccc56)cc4)ccc2-3)c2ccccc21 |
| InChI | InChI=1S/C63H54N2/c1-61(2)50-19-9-13-23-57(50)64(58-24-14-10-20-51(58)61)44-34-36-48-47-35-31-42(39-54(47)63(5,6)55(48)40-44)28-27-41-29-32-43(33-30-41)45-37-38-56(49-18-8-7-17-46(45)49)65-59-25-15-11-21-52(59)62(3,4)53-22-12-16-26-60(53)65/h7-13,15-23,25-40H,14,24H2,1-6H3/b28-27+ |
| InChIKey | SEQPOOAJRNKQDG-BYYHNAKLSA-N |
| XLogP | 17.13 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 839.14 |
| LogP ≤ 5 | 17.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|