About 2-(3-chloro-2-methylcyclohexa-1,5-dien-1-yl)oxypropanal
2-(3-chloro-2-methylcyclohexa-1,5-dien-1-yl)oxypropanal (PubChem CID 89071193) has the molecular formula C10H13ClO2
and a molecular weight of 200.67 g/mol. Its IUPAC name is 2-(3-chloro-2-methylcyclohexa-1,5-dien-1-yl)oxypropanal.
Molecular Properties
| Compound Name | 2-(3-chloro-2-methylcyclohexa-1,5-dien-1-yl)oxypropanal |
| PubChem CID | 89071193 |
| Molecular Formula | C10H13ClO2 |
| Molecular Weight | 200.67 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | 2-(3-chloro-2-methylcyclohexa-1,5-dien-1-yl)oxypropanal |
| SMILES | CC1=C(OC(C)C=O)C=CCC1Cl |
| InChI | InChI=1S/C10H13ClO2/c1-7(6-12)13-10-5-3-4-9(11)8(10)2/h3,5-7,9H,4H2,1-2H3 |
| InChIKey | UMIRLWGALPGZHN-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.67 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-chloro-2-methylcyclohexa-1,5-dien-1-yl)oxypropanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-chloro-2-methylcyclohexa-1,5-dien-1-yl)oxypropanal?
The IUPAC name of 2-(3-chloro-2-methylcyclohexa-1,5-dien-1-yl)oxypropanal (CID 89071193) is 2-(3-chloro-2-methylcyclohexa-1,5-dien-1-yl)oxypropanal.
What is the SMILES notation for 2-(3-chloro-2-methylcyclohexa-1,5-dien-1-yl)oxypropanal?
The canonical SMILES for 2-(3-chloro-2-methylcyclohexa-1,5-dien-1-yl)oxypropanal is CC1=C(OC(C)C=O)C=CCC1Cl.
What is the InChIKey of 2-(3-chloro-2-methylcyclohexa-1,5-dien-1-yl)oxypropanal?
The InChIKey is UMIRLWGALPGZHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13ClO2/c1-7(6-12)13-10-5-3-4-9(11)8(10)2/h3,5-7,9H,4H2,1-2H3.
What are the key properties of 2-(3-chloro-2-methylcyclohexa-1,5-dien-1-yl)oxypropanal?
2-(3-chloro-2-methylcyclohexa-1,5-dien-1-yl)oxypropanal has a molecular weight of 200.67 g/mol, XLogP of 2.43, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-chloro-2-methylcyclohexa-1,5-dien-1-yl)oxypropanal is sourced from PubChem (CID 89071193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).