C10H14O — CID 89071277
2,2-dimethyl-1-[(1R,2S)-2-methylcyclopropyl]but-3-yn-1-one (PubChem CID 89071277) has the molecular formula C10H14O and a molecular weight of 150.22 g/mol. Its IUPAC name is 2,2-dimethyl-1-[(1R,2S)-2-methylcyclopropyl]but-3-yn-1-one.
| Compound Name | 2,2-dimethyl-1-[(1R,2S)-2-methylcyclopropyl]but-3-yn-1-one |
|---|---|
| PubChem CID | 89071277 |
| Molecular Formula | C10H14O |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.10 |
| IUPAC Name | 2,2-dimethyl-1-[(1R,2S)-2-methylcyclopropyl]but-3-yn-1-one |
| SMILES | C#CC(C)(C)C(=O)[C@@H]1C[C@@H]1C |
| InChI | InChI=1S/C10H14O/c1-5-10(3,4)9(11)8-6-7(8)2/h1,7-8H,6H2,2-4H3/t7-,8+/m0/s1 |
| InChIKey | UDMLPJRZKIXKGS-JGVFFNPUSA-N |
| XLogP | 1.87 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|