About 3-[(1Z)-buta-1,3-dienyl]-1-(2-chloroethyl)-2-methylpyrrole
3-[(1Z)-buta-1,3-dienyl]-1-(2-chloroethyl)-2-methylpyrrole (PubChem CID 89071325) has the molecular formula C11H14ClN
and a molecular weight of 195.69 g/mol. Its IUPAC name is 3-[(1Z)-buta-1,3-dienyl]-1-(2-chloroethyl)-2-methylpyrrole.
Molecular Properties
| Compound Name | 3-[(1Z)-buta-1,3-dienyl]-1-(2-chloroethyl)-2-methylpyrrole |
| PubChem CID | 89071325 |
| Molecular Formula | C11H14ClN |
| Molecular Weight | 195.69 g/mol |
| Exact Mass | 195.08 |
| IUPAC Name | 3-[(1Z)-buta-1,3-dienyl]-1-(2-chloroethyl)-2-methylpyrrole |
| SMILES | C=C/C=C\c1ccn(CCCl)c1C |
| InChI | InChI=1S/C11H14ClN/c1-3-4-5-11-6-8-13(9-7-12)10(11)2/h3-6,8H,1,7,9H2,2H3/b5-4- |
| InChIKey | CBUOAQWIXXLQTO-PLNGDYQASA-N |
| XLogP | 3.23 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.69 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 3-[(1Z)-buta-1,3-dienyl]-1-(2-chloroethyl)-2-methylpyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1Z)-buta-1,3-dienyl]-1-(2-chloroethyl)-2-methylpyrrole?
The IUPAC name of 3-[(1Z)-buta-1,3-dienyl]-1-(2-chloroethyl)-2-methylpyrrole (CID 89071325) is 3-[(1Z)-buta-1,3-dienyl]-1-(2-chloroethyl)-2-methylpyrrole.
What is the SMILES notation for 3-[(1Z)-buta-1,3-dienyl]-1-(2-chloroethyl)-2-methylpyrrole?
The canonical SMILES for 3-[(1Z)-buta-1,3-dienyl]-1-(2-chloroethyl)-2-methylpyrrole is C=C/C=C\c1ccn(CCCl)c1C.
What is the InChIKey of 3-[(1Z)-buta-1,3-dienyl]-1-(2-chloroethyl)-2-methylpyrrole?
The InChIKey is CBUOAQWIXXLQTO-PLNGDYQASA-N. The full InChI is InChI=1S/C11H14ClN/c1-3-4-5-11-6-8-13(9-7-12)10(11)2/h3-6,8H,1,7,9H2,2H3/b5-4-.
What are the key properties of 3-[(1Z)-buta-1,3-dienyl]-1-(2-chloroethyl)-2-methylpyrrole?
3-[(1Z)-buta-1,3-dienyl]-1-(2-chloroethyl)-2-methylpyrrole has a molecular weight of 195.69 g/mol, XLogP of 3.23, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1Z)-buta-1,3-dienyl]-1-(2-chloroethyl)-2-methylpyrrole is sourced from PubChem (CID 89071325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).