C25H25N3O7S2 — CID 89072171
(6S)-6-[[5-(3-cyclopropylsulfonylphenyl)-3-methyl-9H-pyrido[2,3-b]indol-8-yl]oxymethyl]-4-methyl-1,3,2,4-dioxathiazinane 2,2-dioxide (PubChem CID 89072171) has the molecular formula C25H25N3O7S2 and a molecular weight of 543.62 g/mol. Its IUPAC name is (6S)-6-[[5-(3-cyclopropylsulfonylphenyl)-3-methyl-9H-pyrido[2,3-b]indol-8-yl]oxymethyl]-4-methyl-1,3,2,4-dioxathiazinane 2,2-dioxide.
| Compound Name | (6S)-6-[[5-(3-cyclopropylsulfonylphenyl)-3-methyl-9H-pyrido[2,3-b]indol-8-yl]oxymethyl]-4-methyl-1,3,2,4-dioxathiazinane 2,2-dioxide |
|---|---|
| PubChem CID | 89072171 |
| Molecular Formula | C25H25N3O7S2 |
| Molecular Weight | 543.62 g/mol |
| Exact Mass | 543.11 |
| IUPAC Name | (6S)-6-[[5-(3-cyclopropylsulfonylphenyl)-3-methyl-9H-pyrido[2,3-b]indol-8-yl]oxymethyl]-4-methyl-1,3,2,4-dioxathiazinane 2,2-dioxide |
| SMILES | Cc1cnc2[nH]c3c(OC[C@@H]4CN(C)OS(=O)(=O)O4)ccc(-c4cccc(S(=O)(=O)C5CC5)c4)c3c2c1 |
| InChI | InChI=1S/C25H25N3O7S2/c1-15-10-21-23-20(16-4-3-5-19(11-16)36(29,30)18-6-7-18)8-9-22(24(23)27-25(21)26-12-15)33-14-17-13-28(2)35-37(31,32)34-17/h3-5,8-12,17-18H,6-7,13-14H2,1-2H3,(H,26,27)/t17-/m0/s1 |
| InChIKey | UOROEUCFLPZUAC-KRWDZBQOSA-N |
| XLogP | 3.51 |
| TPSA | 127.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.62 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |