C14H9Cl2FN2O2S — CID 89072207
1-chloro-4-[2-chloro-4-[cyanomethyl(sulfino)amino]phenyl]-2-fluorobenzene (PubChem CID 89072207) has the molecular formula C14H9Cl2FN2O2S and a molecular weight of 359.21 g/mol. Its IUPAC name is 1-chloro-4-[2-chloro-4-[cyanomethyl(sulfino)amino]phenyl]-2-fluorobenzene.
| Compound Name | 1-chloro-4-[2-chloro-4-[cyanomethyl(sulfino)amino]phenyl]-2-fluorobenzene |
|---|---|
| PubChem CID | 89072207 |
| Molecular Formula | C14H9Cl2FN2O2S |
| Molecular Weight | 359.21 g/mol |
| Exact Mass | 357.97 |
| IUPAC Name | 1-chloro-4-[2-chloro-4-[cyanomethyl(sulfino)amino]phenyl]-2-fluorobenzene |
| SMILES | N#CCN(c1ccc(-c2ccc(Cl)c(F)c2)c(Cl)c1)S(=O)O |
| InChI | InChI=1S/C14H9Cl2FN2O2S/c15-12-4-1-9(7-14(12)17)11-3-2-10(8-13(11)16)19(6-5-18)22(20)21/h1-4,7-8H,6H2,(H,20,21) |
| InChIKey | FCFZCRRBRARMNJ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 64.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.21 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|