About 3-propoxybutylhydrazine
3-propoxybutylhydrazine (PubChem CID 89072504) has the molecular formula C7H18N2O
and a molecular weight of 146.23 g/mol. Its IUPAC name is 3-propoxybutylhydrazine.
Molecular Properties
| Compound Name | 3-propoxybutylhydrazine |
| PubChem CID | 89072504 |
| Molecular Formula | C7H18N2O |
| Molecular Weight | 146.23 g/mol |
| Exact Mass | 146.14 |
| IUPAC Name | 3-propoxybutylhydrazine |
| SMILES | CCCOC(C)CCNN |
| InChI | InChI=1S/C7H18N2O/c1-3-6-10-7(2)4-5-9-8/h7,9H,3-6,8H2,1-2H3 |
| InChIKey | WUNCSDLOFJXQJY-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.23 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-propoxybutylhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-propoxybutylhydrazine?
The IUPAC name of 3-propoxybutylhydrazine (CID 89072504) is 3-propoxybutylhydrazine.
What is the SMILES notation for 3-propoxybutylhydrazine?
The canonical SMILES for 3-propoxybutylhydrazine is CCCOC(C)CCNN.
What is the InChIKey of 3-propoxybutylhydrazine?
The InChIKey is WUNCSDLOFJXQJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H18N2O/c1-3-6-10-7(2)4-5-9-8/h7,9H,3-6,8H2,1-2H3.
What are the key properties of 3-propoxybutylhydrazine?
3-propoxybutylhydrazine has a molecular weight of 146.23 g/mol, XLogP of 0.65, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-propoxybutylhydrazine is sourced from PubChem (CID 89072504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).