About 1-(4-ethylcyclohexa-1,3-dien-1-yl)ethanimine
1-(4-ethylcyclohexa-1,3-dien-1-yl)ethanimine (PubChem CID 89073024) has the molecular formula C10H15N
and a molecular weight of 149.24 g/mol. Its IUPAC name is 1-(4-ethylcyclohexa-1,3-dien-1-yl)ethanimine.
Molecular Properties
| Compound Name | 1-(4-ethylcyclohexa-1,3-dien-1-yl)ethanimine |
| PubChem CID | 89073024 |
| Molecular Formula | C10H15N |
| Molecular Weight | 149.24 g/mol |
| Exact Mass | 149.12 |
| IUPAC Name | 1-(4-ethylcyclohexa-1,3-dien-1-yl)ethanimine |
| SMILES | [H]/N=C(\C)C1=CC=C(CC)CC1 |
| InChI | InChI=1S/C10H15N/c1-3-9-4-6-10(7-5-9)8(2)11/h4,6,11H,3,5,7H2,1-2H3/b11-8+ |
| InChIKey | UOBTVEBWEKLNDF-DHZHZOJOSA-N |
| XLogP | 3.08 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.24 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-ethylcyclohexa-1,3-dien-1-yl)ethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-ethylcyclohexa-1,3-dien-1-yl)ethanimine?
The IUPAC name of 1-(4-ethylcyclohexa-1,3-dien-1-yl)ethanimine (CID 89073024) is 1-(4-ethylcyclohexa-1,3-dien-1-yl)ethanimine.
What is the SMILES notation for 1-(4-ethylcyclohexa-1,3-dien-1-yl)ethanimine?
The canonical SMILES for 1-(4-ethylcyclohexa-1,3-dien-1-yl)ethanimine is [H]/N=C(\C)C1=CC=C(CC)CC1.
What is the InChIKey of 1-(4-ethylcyclohexa-1,3-dien-1-yl)ethanimine?
The InChIKey is UOBTVEBWEKLNDF-DHZHZOJOSA-N. The full InChI is InChI=1S/C10H15N/c1-3-9-4-6-10(7-5-9)8(2)11/h4,6,11H,3,5,7H2,1-2H3/b11-8+.
What are the key properties of 1-(4-ethylcyclohexa-1,3-dien-1-yl)ethanimine?
1-(4-ethylcyclohexa-1,3-dien-1-yl)ethanimine has a molecular weight of 149.24 g/mol, XLogP of 3.08, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-ethylcyclohexa-1,3-dien-1-yl)ethanimine is sourced from PubChem (CID 89073024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).