C24H28O3 — CID 89073128
4-[2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1,3-dioxolan-2-yl]benzaldehyde (PubChem CID 89073128) has the molecular formula C24H28O3 and a molecular weight of 364.49 g/mol. Its IUPAC name is 4-[2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1,3-dioxolan-2-yl]benzaldehyde.
| Compound Name | 4-[2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1,3-dioxolan-2-yl]benzaldehyde |
|---|---|
| PubChem CID | 89073128 |
| Molecular Formula | C24H28O3 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | 4-[2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1,3-dioxolan-2-yl]benzaldehyde |
| SMILES | CC1(C)CCC(C)(C)c2cc(C3(c4ccc(C=O)cc4)OCCO3)ccc21 |
| InChI | InChI=1S/C24H28O3/c1-22(2)11-12-23(3,4)21-15-19(9-10-20(21)22)24(26-13-14-27-24)18-7-5-17(16-25)6-8-18/h5-10,15-16H,11-14H2,1-4H3 |
| InChIKey | SUBABPWGUKLPRB-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|