C20H35N — CID 89073266
(7E,8Z)-4,5-dimethyl-7-(2-methylprop-2-enylidene)-3-propylundeca-8,10-dien-1-amine (PubChem CID 89073266) has the molecular formula C20H35N and a molecular weight of 289.51 g/mol. Its IUPAC name is (7E,8Z)-4,5-dimethyl-7-(2-methylprop-2-enylidene)-3-propylundeca-8,10-dien-1-amine.
| Compound Name | (7E,8Z)-4,5-dimethyl-7-(2-methylprop-2-enylidene)-3-propylundeca-8,10-dien-1-amine |
|---|---|
| PubChem CID | 89073266 |
| Molecular Formula | C20H35N |
| Molecular Weight | 289.51 g/mol |
| Exact Mass | 289.28 |
| IUPAC Name | (7E,8Z)-4,5-dimethyl-7-(2-methylprop-2-enylidene)-3-propylundeca-8,10-dien-1-amine |
| SMILES | C=C/C=C\C(=C\C(=C)C)CC(C)C(C)C(CCC)CCN |
| InChI | InChI=1S/C20H35N/c1-7-9-11-19(14-16(3)4)15-17(5)18(6)20(10-8-2)12-13-21/h7,9,11,14,17-18,20H,1,3,8,10,12-13,15,21H2,2,4-6H3/b11-9-,19-14- |
| InChIKey | QOLUMZYYCKPMEL-FVDMYRIMSA-N |
| XLogP | 5.66 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.51 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|