About 3-[(E)-3,3,3-trifluoro-2-methylprop-1-enyl]iminobutan-2-one
3-[(E)-3,3,3-trifluoro-2-methylprop-1-enyl]iminobutan-2-one (PubChem CID 89073507) has the molecular formula C8H10F3NO
and a molecular weight of 193.17 g/mol. Its IUPAC name is 3-[(E)-3,3,3-trifluoro-2-methylprop-1-enyl]iminobutan-2-one.
Molecular Properties
| Compound Name | 3-[(E)-3,3,3-trifluoro-2-methylprop-1-enyl]iminobutan-2-one |
| PubChem CID | 89073507 |
| Molecular Formula | C8H10F3NO |
| Molecular Weight | 193.17 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | 3-[(E)-3,3,3-trifluoro-2-methylprop-1-enyl]iminobutan-2-one |
| SMILES | CC(=O)/C(C)=N/C=C(\C)C(F)(F)F |
| InChI | InChI=1S/C8H10F3NO/c1-5(8(9,10)11)4-12-6(2)7(3)13/h4H,1-3H3/b5-4+,12-6+ |
| InChIKey | VGOAYZBGQTVPDV-ICLXBRQCSA-N |
| XLogP | 2.50 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.17 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-[(E)-3,3,3-trifluoro-2-methylprop-1-enyl]iminobutan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(E)-3,3,3-trifluoro-2-methylprop-1-enyl]iminobutan-2-one?
The IUPAC name of 3-[(E)-3,3,3-trifluoro-2-methylprop-1-enyl]iminobutan-2-one (CID 89073507) is 3-[(E)-3,3,3-trifluoro-2-methylprop-1-enyl]iminobutan-2-one.
What is the SMILES notation for 3-[(E)-3,3,3-trifluoro-2-methylprop-1-enyl]iminobutan-2-one?
The canonical SMILES for 3-[(E)-3,3,3-trifluoro-2-methylprop-1-enyl]iminobutan-2-one is CC(=O)/C(C)=N/C=C(\C)C(F)(F)F.
What is the InChIKey of 3-[(E)-3,3,3-trifluoro-2-methylprop-1-enyl]iminobutan-2-one?
The InChIKey is VGOAYZBGQTVPDV-ICLXBRQCSA-N. The full InChI is InChI=1S/C8H10F3NO/c1-5(8(9,10)11)4-12-6(2)7(3)13/h4H,1-3H3/b5-4+,12-6+.
What are the key properties of 3-[(E)-3,3,3-trifluoro-2-methylprop-1-enyl]iminobutan-2-one?
3-[(E)-3,3,3-trifluoro-2-methylprop-1-enyl]iminobutan-2-one has a molecular weight of 193.17 g/mol, XLogP of 2.50, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(E)-3,3,3-trifluoro-2-methylprop-1-enyl]iminobutan-2-one is sourced from PubChem (CID 89073507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).