About 2,5-difluoro-1-methylsulfonylcyclohexa-1,3-diene
2,5-difluoro-1-methylsulfonylcyclohexa-1,3-diene (PubChem CID 89073524) has the molecular formula C7H8F2O2S
and a molecular weight of 194.20 g/mol. Its IUPAC name is 2,5-difluoro-1-methylsulfonylcyclohexa-1,3-diene.
Molecular Properties
| Compound Name | 2,5-difluoro-1-methylsulfonylcyclohexa-1,3-diene |
| PubChem CID | 89073524 |
| Molecular Formula | C7H8F2O2S |
| Molecular Weight | 194.20 g/mol |
| Exact Mass | 194.02 |
| IUPAC Name | 2,5-difluoro-1-methylsulfonylcyclohexa-1,3-diene |
| SMILES | CS(=O)(=O)C1=C(F)C=CC(F)C1 |
| InChI | InChI=1S/C7H8F2O2S/c1-12(10,11)7-4-5(8)2-3-6(7)9/h2-3,5H,4H2,1H3 |
| InChIKey | ZKSVWNGRASZCPS-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.20 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,5-difluoro-1-methylsulfonylcyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-difluoro-1-methylsulfonylcyclohexa-1,3-diene?
The IUPAC name of 2,5-difluoro-1-methylsulfonylcyclohexa-1,3-diene (CID 89073524) is 2,5-difluoro-1-methylsulfonylcyclohexa-1,3-diene.
What is the SMILES notation for 2,5-difluoro-1-methylsulfonylcyclohexa-1,3-diene?
The canonical SMILES for 2,5-difluoro-1-methylsulfonylcyclohexa-1,3-diene is CS(=O)(=O)C1=C(F)C=CC(F)C1.
What is the InChIKey of 2,5-difluoro-1-methylsulfonylcyclohexa-1,3-diene?
The InChIKey is ZKSVWNGRASZCPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8F2O2S/c1-12(10,11)7-4-5(8)2-3-6(7)9/h2-3,5H,4H2,1H3.
What are the key properties of 2,5-difluoro-1-methylsulfonylcyclohexa-1,3-diene?
2,5-difluoro-1-methylsulfonylcyclohexa-1,3-diene has a molecular weight of 194.20 g/mol, XLogP of 1.51, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-difluoro-1-methylsulfonylcyclohexa-1,3-diene is sourced from PubChem (CID 89073524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).