C8H10F5N — CID 89073622
(5Z)-5,7,7,7-tetrafluoro-6-(fluoromethyl)hepta-1,5-dien-3-amine (PubChem CID 89073622) has the molecular formula C8H10F5N and a molecular weight of 215.16 g/mol. Its IUPAC name is (5Z)-5,7,7,7-tetrafluoro-6-(fluoromethyl)hepta-1,5-dien-3-amine.
| Compound Name | (5Z)-5,7,7,7-tetrafluoro-6-(fluoromethyl)hepta-1,5-dien-3-amine |
|---|---|
| PubChem CID | 89073622 |
| Molecular Formula | C8H10F5N |
| Molecular Weight | 215.16 g/mol |
| Exact Mass | 215.07 |
| IUPAC Name | (5Z)-5,7,7,7-tetrafluoro-6-(fluoromethyl)hepta-1,5-dien-3-amine |
| SMILES | C=CC(N)C/C(F)=C(\CF)C(F)(F)F |
| InChI | InChI=1S/C8H10F5N/c1-2-5(14)3-7(10)6(4-9)8(11,12)13/h2,5H,1,3-4,14H2/b7-6- |
| InChIKey | DZZJCXUBNPGICS-SREVYHEPSA-N |
| XLogP | 2.65 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.16 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|