About 2-ethenyl-2,3-dihydroquinoxaline
2-ethenyl-2,3-dihydroquinoxaline (PubChem CID 89073663) has the molecular formula C10H10N2
and a molecular weight of 158.20 g/mol. Its IUPAC name is 2-ethenyl-2,3-dihydroquinoxaline.
Molecular Properties
| Compound Name | 2-ethenyl-2,3-dihydroquinoxaline |
| PubChem CID | 89073663 |
| Molecular Formula | C10H10N2 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.08 |
| IUPAC Name | 2-ethenyl-2,3-dihydroquinoxaline |
| SMILES | C=CC1CN=c2ccccc2=N1 |
| InChI | InChI=1S/C10H10N2/c1-2-8-7-11-9-5-3-4-6-10(9)12-8/h2-6,8H,1,7H2 |
| InChIKey | GFNSZDJURLWIPP-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-ethenyl-2,3-dihydroquinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethenyl-2,3-dihydroquinoxaline?
The IUPAC name of 2-ethenyl-2,3-dihydroquinoxaline (CID 89073663) is 2-ethenyl-2,3-dihydroquinoxaline.
What is the SMILES notation for 2-ethenyl-2,3-dihydroquinoxaline?
The canonical SMILES for 2-ethenyl-2,3-dihydroquinoxaline is C=CC1CN=c2ccccc2=N1.
What is the InChIKey of 2-ethenyl-2,3-dihydroquinoxaline?
The InChIKey is GFNSZDJURLWIPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2/c1-2-8-7-11-9-5-3-4-6-10(9)12-8/h2-6,8H,1,7H2.
What are the key properties of 2-ethenyl-2,3-dihydroquinoxaline?
2-ethenyl-2,3-dihydroquinoxaline has a molecular weight of 158.20 g/mol, XLogP of 0.49, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethenyl-2,3-dihydroquinoxaline is sourced from PubChem (CID 89073663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).