C18H27ClN2O — CID 89073708
1-[(2E,4E)-5-aminohexa-2,4-dien-2-yl]-4-[(1E,3E,5Z)-4-chlorohepta-1,3,5-trienyl]piperidin-4-ol (PubChem CID 89073708) has the molecular formula C18H27ClN2O and a molecular weight of 322.88 g/mol. Its IUPAC name is 1-[(2E,4E)-5-aminohexa-2,4-dien-2-yl]-4-[(1E,3E,5Z)-4-chlorohepta-1,3,5-trienyl]piperidin-4-ol.
| Compound Name | 1-[(2E,4E)-5-aminohexa-2,4-dien-2-yl]-4-[(1E,3E,5Z)-4-chlorohepta-1,3,5-trienyl]piperidin-4-ol |
|---|---|
| PubChem CID | 89073708 |
| Molecular Formula | C18H27ClN2O |
| Molecular Weight | 322.88 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | 1-[(2E,4E)-5-aminohexa-2,4-dien-2-yl]-4-[(1E,3E,5Z)-4-chlorohepta-1,3,5-trienyl]piperidin-4-ol |
| SMILES | C/C=C\C(Cl)=C/C=C/C1(O)CCN(/C(C)=C/C=C(\C)N)CC1 |
| InChI | InChI=1S/C18H27ClN2O/c1-4-6-17(19)7-5-10-18(22)11-13-21(14-12-18)16(3)9-8-15(2)20/h4-10,22H,11-14,20H2,1-3H3/b6-4-,10-5+,15-8+,16-9+,17-7+ |
| InChIKey | QCPWQRYHRPDEBK-PJODVINHSA-N |
| XLogP | 3.83 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.88 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|