About (1R,4S)-3,4-difluorocyclohex-2-en-1-amine
(1R,4S)-3,4-difluorocyclohex-2-en-1-amine (PubChem CID 89073713) has the molecular formula C6H9F2N
and a molecular weight of 133.14 g/mol. Its IUPAC name is (1R,4S)-3,4-difluorocyclohex-2-en-1-amine.
Molecular Properties
| Compound Name | (1R,4S)-3,4-difluorocyclohex-2-en-1-amine |
| PubChem CID | 89073713 |
| Molecular Formula | C6H9F2N |
| Molecular Weight | 133.14 g/mol |
| Exact Mass | 133.07 |
| IUPAC Name | (1R,4S)-3,4-difluorocyclohex-2-en-1-amine |
| SMILES | N[C@H]1C=C(F)[C@@H](F)CC1 |
| InChI | InChI=1S/C6H9F2N/c7-5-2-1-4(9)3-6(5)8/h3-5H,1-2,9H2/t4-,5+/m1/s1 |
| InChIKey | XMKKJQNYSSBIEH-UHNVWZDZSA-N |
| XLogP | 1.30 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.14 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (1R,4S)-3,4-difluorocyclohex-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,4S)-3,4-difluorocyclohex-2-en-1-amine?
The IUPAC name of (1R,4S)-3,4-difluorocyclohex-2-en-1-amine (CID 89073713) is (1R,4S)-3,4-difluorocyclohex-2-en-1-amine.
What is the SMILES notation for (1R,4S)-3,4-difluorocyclohex-2-en-1-amine?
The canonical SMILES for (1R,4S)-3,4-difluorocyclohex-2-en-1-amine is N[C@H]1C=C(F)[C@@H](F)CC1.
What is the InChIKey of (1R,4S)-3,4-difluorocyclohex-2-en-1-amine?
The InChIKey is XMKKJQNYSSBIEH-UHNVWZDZSA-N. The full InChI is InChI=1S/C6H9F2N/c7-5-2-1-4(9)3-6(5)8/h3-5H,1-2,9H2/t4-,5+/m1/s1.
What are the key properties of (1R,4S)-3,4-difluorocyclohex-2-en-1-amine?
(1R,4S)-3,4-difluorocyclohex-2-en-1-amine has a molecular weight of 133.14 g/mol, XLogP of 1.30, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,4S)-3,4-difluorocyclohex-2-en-1-amine is sourced from PubChem (CID 89073713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).