About (3E,5E)-6-methoxyhexa-3,5-dien-3-amine
(3E,5E)-6-methoxyhexa-3,5-dien-3-amine (PubChem CID 89073724) has the molecular formula C7H13NO
and a molecular weight of 127.19 g/mol. Its IUPAC name is (3E,5E)-6-methoxyhexa-3,5-dien-3-amine.
Molecular Properties
| Compound Name | (3E,5E)-6-methoxyhexa-3,5-dien-3-amine |
| PubChem CID | 89073724 |
| Molecular Formula | C7H13NO |
| Molecular Weight | 127.19 g/mol |
| Exact Mass | 127.10 |
| IUPAC Name | (3E,5E)-6-methoxyhexa-3,5-dien-3-amine |
| SMILES | CC/C(N)=C\C=C\OC |
| InChI | InChI=1S/C7H13NO/c1-3-7(8)5-4-6-9-2/h4-6H,3,8H2,1-2H3/b6-4+,7-5+ |
| InChIKey | XUWCYEGPBGGFTG-YDFGWWAZSA-N |
| XLogP | 1.40 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.19 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3E,5E)-6-methoxyhexa-3,5-dien-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E,5E)-6-methoxyhexa-3,5-dien-3-amine?
The IUPAC name of (3E,5E)-6-methoxyhexa-3,5-dien-3-amine (CID 89073724) is (3E,5E)-6-methoxyhexa-3,5-dien-3-amine.
What is the SMILES notation for (3E,5E)-6-methoxyhexa-3,5-dien-3-amine?
The canonical SMILES for (3E,5E)-6-methoxyhexa-3,5-dien-3-amine is CC/C(N)=C\C=C\OC.
What is the InChIKey of (3E,5E)-6-methoxyhexa-3,5-dien-3-amine?
The InChIKey is XUWCYEGPBGGFTG-YDFGWWAZSA-N. The full InChI is InChI=1S/C7H13NO/c1-3-7(8)5-4-6-9-2/h4-6H,3,8H2,1-2H3/b6-4+,7-5+.
What are the key properties of (3E,5E)-6-methoxyhexa-3,5-dien-3-amine?
(3E,5E)-6-methoxyhexa-3,5-dien-3-amine has a molecular weight of 127.19 g/mol, XLogP of 1.40, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3E,5E)-6-methoxyhexa-3,5-dien-3-amine is sourced from PubChem (CID 89073724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).