C14H26N2O — CID 89073742
(3R,5E)-6-[(2S,6R)-2,6-dimethylmorpholin-4-yl]octa-1,5-dien-3-amine (PubChem CID 89073742) has the molecular formula C14H26N2O and a molecular weight of 238.37 g/mol. Its IUPAC name is (3R,5E)-6-[(2S,6R)-2,6-dimethylmorpholin-4-yl]octa-1,5-dien-3-amine.
| Compound Name | (3R,5E)-6-[(2S,6R)-2,6-dimethylmorpholin-4-yl]octa-1,5-dien-3-amine |
|---|---|
| PubChem CID | 89073742 |
| Molecular Formula | C14H26N2O |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.20 |
| IUPAC Name | (3R,5E)-6-[(2S,6R)-2,6-dimethylmorpholin-4-yl]octa-1,5-dien-3-amine |
| SMILES | C=C[C@H](N)C/C=C(\CC)N1C[C@@H](C)O[C@@H](C)C1 |
| InChI | InChI=1S/C14H26N2O/c1-5-13(15)7-8-14(6-2)16-9-11(3)17-12(4)10-16/h5,8,11-13H,1,6-7,9-10,15H2,2-4H3/b14-8+/t11-,12+,13-/m0/s1 |
| InChIKey | QRUREILEYIIHLF-PKVZETHASA-N |
| XLogP | 2.29 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|