About 5-cyclohexa-1,5-dien-1-yloxycyclohexa-1,5-dien-1-amine
5-cyclohexa-1,5-dien-1-yloxycyclohexa-1,5-dien-1-amine (PubChem CID 89073798) has the molecular formula C12H15NO
and a molecular weight of 189.26 g/mol. Its IUPAC name is 5-cyclohexa-1,5-dien-1-yloxycyclohexa-1,5-dien-1-amine.
Molecular Properties
| Compound Name | 5-cyclohexa-1,5-dien-1-yloxycyclohexa-1,5-dien-1-amine |
| PubChem CID | 89073798 |
| Molecular Formula | C12H15NO |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.12 |
| IUPAC Name | 5-cyclohexa-1,5-dien-1-yloxycyclohexa-1,5-dien-1-amine |
| SMILES | NC1=CCCC(OC2=CCCC=C2)=C1 |
| InChI | InChI=1S/C12H15NO/c13-10-5-4-8-12(9-10)14-11-6-2-1-3-7-11/h2,5-7,9H,1,3-4,8,13H2 |
| InChIKey | AUFYMKZFOACTNW-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-cyclohexa-1,5-dien-1-yloxycyclohexa-1,5-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyclohexa-1,5-dien-1-yloxycyclohexa-1,5-dien-1-amine?
The IUPAC name of 5-cyclohexa-1,5-dien-1-yloxycyclohexa-1,5-dien-1-amine (CID 89073798) is 5-cyclohexa-1,5-dien-1-yloxycyclohexa-1,5-dien-1-amine.
What is the SMILES notation for 5-cyclohexa-1,5-dien-1-yloxycyclohexa-1,5-dien-1-amine?
The canonical SMILES for 5-cyclohexa-1,5-dien-1-yloxycyclohexa-1,5-dien-1-amine is NC1=CCCC(OC2=CCCC=C2)=C1.
What is the InChIKey of 5-cyclohexa-1,5-dien-1-yloxycyclohexa-1,5-dien-1-amine?
The InChIKey is AUFYMKZFOACTNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO/c13-10-5-4-8-12(9-10)14-11-6-2-1-3-7-11/h2,5-7,9H,1,3-4,8,13H2.
What are the key properties of 5-cyclohexa-1,5-dien-1-yloxycyclohexa-1,5-dien-1-amine?
5-cyclohexa-1,5-dien-1-yloxycyclohexa-1,5-dien-1-amine has a molecular weight of 189.26 g/mol, XLogP of 2.76, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyclohexa-1,5-dien-1-yloxycyclohexa-1,5-dien-1-amine is sourced from PubChem (CID 89073798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).