About 2,3-dimethyl-4-(oxolan-2-yl)cyclohexa-2,4-dien-1-amine
2,3-dimethyl-4-(oxolan-2-yl)cyclohexa-2,4-dien-1-amine (PubChem CID 89073822) has the molecular formula C12H19NO
and a molecular weight of 193.29 g/mol. Its IUPAC name is 2,3-dimethyl-4-(oxolan-2-yl)cyclohexa-2,4-dien-1-amine.
Molecular Properties
| Compound Name | 2,3-dimethyl-4-(oxolan-2-yl)cyclohexa-2,4-dien-1-amine |
| PubChem CID | 89073822 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | 2,3-dimethyl-4-(oxolan-2-yl)cyclohexa-2,4-dien-1-amine |
| SMILES | CC1=C(C)C(N)CC=C1C1CCCO1 |
| InChI | InChI=1S/C12H19NO/c1-8-9(2)11(13)6-5-10(8)12-4-3-7-14-12/h5,11-12H,3-4,6-7,13H2,1-2H3 |
| InChIKey | BODCOJXSYMXWDW-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,3-dimethyl-4-(oxolan-2-yl)cyclohexa-2,4-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethyl-4-(oxolan-2-yl)cyclohexa-2,4-dien-1-amine?
The IUPAC name of 2,3-dimethyl-4-(oxolan-2-yl)cyclohexa-2,4-dien-1-amine (CID 89073822) is 2,3-dimethyl-4-(oxolan-2-yl)cyclohexa-2,4-dien-1-amine.
What is the SMILES notation for 2,3-dimethyl-4-(oxolan-2-yl)cyclohexa-2,4-dien-1-amine?
The canonical SMILES for 2,3-dimethyl-4-(oxolan-2-yl)cyclohexa-2,4-dien-1-amine is CC1=C(C)C(N)CC=C1C1CCCO1.
What is the InChIKey of 2,3-dimethyl-4-(oxolan-2-yl)cyclohexa-2,4-dien-1-amine?
The InChIKey is BODCOJXSYMXWDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19NO/c1-8-9(2)11(13)6-5-10(8)12-4-3-7-14-12/h5,11-12H,3-4,6-7,13H2,1-2H3.
What are the key properties of 2,3-dimethyl-4-(oxolan-2-yl)cyclohexa-2,4-dien-1-amine?
2,3-dimethyl-4-(oxolan-2-yl)cyclohexa-2,4-dien-1-amine has a molecular weight of 193.29 g/mol, XLogP of 2.16, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethyl-4-(oxolan-2-yl)cyclohexa-2,4-dien-1-amine is sourced from PubChem (CID 89073822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).