C12H20F2N2O — CID 89073873
(2E,4E)-5-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-1,6-difluorohexa-2,4-dien-2-amine (PubChem CID 89073873) has the molecular formula C12H20F2N2O and a molecular weight of 246.30 g/mol. Its IUPAC name is (2E,4E)-5-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-1,6-difluorohexa-2,4-dien-2-amine.
| Compound Name | (2E,4E)-5-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-1,6-difluorohexa-2,4-dien-2-amine |
|---|---|
| PubChem CID | 89073873 |
| Molecular Formula | C12H20F2N2O |
| Molecular Weight | 246.30 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | (2E,4E)-5-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-1,6-difluorohexa-2,4-dien-2-amine |
| SMILES | C[C@@H]1CN(/C(=C/C=C(/N)CF)CF)C[C@H](C)O1 |
| InChI | InChI=1S/C12H20F2N2O/c1-9-7-16(8-10(2)17-9)12(6-14)4-3-11(15)5-13/h3-4,9-10H,5-8,15H2,1-2H3/b11-3+,12-4+/t9-,10+ |
| InChIKey | GDLHTMLQJHKJLN-FTEUKKGVSA-N |
| XLogP | 1.76 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.30 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|