C7H11NO2 — CID 89073878
(2E,4E)-4-aminohepta-2,4,6-triene-1,2-diol (PubChem CID 89073878) has the molecular formula C7H11NO2 and a molecular weight of 141.17 g/mol. Its IUPAC name is (2E,4E)-4-aminohepta-2,4,6-triene-1,2-diol.
| Compound Name | (2E,4E)-4-aminohepta-2,4,6-triene-1,2-diol |
|---|---|
| PubChem CID | 89073878 |
| Molecular Formula | C7H11NO2 |
| Molecular Weight | 141.17 g/mol |
| Exact Mass | 141.08 |
| IUPAC Name | (2E,4E)-4-aminohepta-2,4,6-triene-1,2-diol |
| SMILES | C=C/C=C(N)\C=C(\O)CO |
| InChI | InChI=1S/C7H11NO2/c1-2-3-6(8)4-7(10)5-9/h2-4,9-10H,1,5,8H2/b6-3+,7-4+ |
| InChIKey | RKKWCOJKKYFESR-XOKGJFMYSA-N |
| XLogP | 0.45 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.17 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|