C14H23N3O — CID 89073918
(3Z)-1-[(3-aminocyclohexa-2,4-dien-1-yl)amino]-2-methyl-5-(methylamino)hexa-3,5-dien-1-ol (PubChem CID 89073918) has the molecular formula C14H23N3O and a molecular weight of 249.36 g/mol. Its IUPAC name is (3Z)-1-[(3-aminocyclohexa-2,4-dien-1-yl)amino]-2-methyl-5-(methylamino)hexa-3,5-dien-1-ol.
| Compound Name | (3Z)-1-[(3-aminocyclohexa-2,4-dien-1-yl)amino]-2-methyl-5-(methylamino)hexa-3,5-dien-1-ol |
|---|---|
| PubChem CID | 89073918 |
| Molecular Formula | C14H23N3O |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.18 |
| IUPAC Name | (3Z)-1-[(3-aminocyclohexa-2,4-dien-1-yl)amino]-2-methyl-5-(methylamino)hexa-3,5-dien-1-ol |
| SMILES | C=C(/C=C\C(C)C(O)NC1C=C(N)C=CC1)NC |
| InChI | InChI=1S/C14H23N3O/c1-10(7-8-11(2)16-3)14(18)17-13-6-4-5-12(15)9-13/h4-5,7-10,13-14,16-18H,2,6,15H2,1,3H3/b8-7- |
| InChIKey | FRSYJDMNAVZDKA-FPLPWBNLSA-N |
| XLogP | 0.99 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|