C8H11F4N — CID 89073929
(5E)-6,8,8,8-tetrafluoroocta-1,5-dien-3-amine (PubChem CID 89073929) has the molecular formula C8H11F4N and a molecular weight of 197.17 g/mol. Its IUPAC name is (5E)-6,8,8,8-tetrafluoroocta-1,5-dien-3-amine.
| Compound Name | (5E)-6,8,8,8-tetrafluoroocta-1,5-dien-3-amine |
|---|---|
| PubChem CID | 89073929 |
| Molecular Formula | C8H11F4N |
| Molecular Weight | 197.17 g/mol |
| Exact Mass | 197.08 |
| IUPAC Name | (5E)-6,8,8,8-tetrafluoroocta-1,5-dien-3-amine |
| SMILES | C=CC(N)C/C=C(/F)CC(F)(F)F |
| InChI | InChI=1S/C8H11F4N/c1-2-7(13)4-3-6(9)5-8(10,11)12/h2-3,7H,1,4-5,13H2/b6-3+ |
| InChIKey | CKGXAPGBVGGHON-ZZXKWVIFSA-N |
| XLogP | 2.70 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.17 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|