C9H15NO4 — CID 89073946
N-(3,4,5-trimethoxycyclohexa-1,5-dien-1-yl)hydroxylamine (PubChem CID 89073946) has the molecular formula C9H15NO4 and a molecular weight of 201.22 g/mol. Its IUPAC name is N-(3,4,5-trimethoxycyclohexa-1,5-dien-1-yl)hydroxylamine.
| Compound Name | N-(3,4,5-trimethoxycyclohexa-1,5-dien-1-yl)hydroxylamine |
|---|---|
| PubChem CID | 89073946 |
| Molecular Formula | C9H15NO4 |
| Molecular Weight | 201.22 g/mol |
| Exact Mass | 201.10 |
| IUPAC Name | N-(3,4,5-trimethoxycyclohexa-1,5-dien-1-yl)hydroxylamine |
| SMILES | COC1=CC(NO)=CC(OC)C1OC |
| InChI | InChI=1S/C9H15NO4/c1-12-7-4-6(10-11)5-8(13-2)9(7)14-3/h4-5,7,9-11H,1-3H3 |
| InChIKey | MUEJXFSRZHYGOZ-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 59.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.22 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|