C12H20N2 — CID 89073961
(4Z,6Z)-8-N-ethyl-2-methylidenenona-4,6,8-triene-1,8-diamine (PubChem CID 89073961) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is (4Z,6Z)-8-N-ethyl-2-methylidenenona-4,6,8-triene-1,8-diamine.
| Compound Name | (4Z,6Z)-8-N-ethyl-2-methylidenenona-4,6,8-triene-1,8-diamine |
|---|---|
| PubChem CID | 89073961 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | (4Z,6Z)-8-N-ethyl-2-methylidenenona-4,6,8-triene-1,8-diamine |
| SMILES | C=C(CN)C/C=C\C=C/C(=C)NCC |
| InChI | InChI=1S/C12H20N2/c1-4-14-12(3)9-7-5-6-8-11(2)10-13/h5-7,9,14H,2-4,8,10,13H2,1H3/b6-5-,9-7- |
| InChIKey | KYWLRCZOMSPGBO-LZWBOMALSA-N |
| XLogP | 2.13 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|