C10H14N2O — CID 89073970
N-(1-methyl-2,3,7,7a-tetrahydroindol-5-yl)formamide (PubChem CID 89073970) has the molecular formula C10H14N2O and a molecular weight of 178.24 g/mol. Its IUPAC name is N-(1-methyl-2,3,7,7a-tetrahydroindol-5-yl)formamide.
| Compound Name | N-(1-methyl-2,3,7,7a-tetrahydroindol-5-yl)formamide |
|---|---|
| PubChem CID | 89073970 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.24 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | N-(1-methyl-2,3,7,7a-tetrahydroindol-5-yl)formamide |
| SMILES | CN1CCC2=CC(NC=O)=CCC21 |
| InChI | InChI=1S/C10H14N2O/c1-12-5-4-8-6-9(11-7-13)2-3-10(8)12/h2,6-7,10H,3-5H2,1H3,(H,11,13) |
| InChIKey | JKTVEEJSZCAPHU-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.24 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|