C13H24N2O — CID 89073971
(2E,4E)-2-N-(2-propan-2-yloxypropyl)hepta-2,4,6-triene-2,5-diamine (PubChem CID 89073971) has the molecular formula C13H24N2O and a molecular weight of 224.35 g/mol. Its IUPAC name is (2E,4E)-2-N-(2-propan-2-yloxypropyl)hepta-2,4,6-triene-2,5-diamine.
| Compound Name | (2E,4E)-2-N-(2-propan-2-yloxypropyl)hepta-2,4,6-triene-2,5-diamine |
|---|---|
| PubChem CID | 89073971 |
| Molecular Formula | C13H24N2O |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.19 |
| IUPAC Name | (2E,4E)-2-N-(2-propan-2-yloxypropyl)hepta-2,4,6-triene-2,5-diamine |
| SMILES | C=C/C(N)=C\C=C(/C)NCC(C)OC(C)C |
| InChI | InChI=1S/C13H24N2O/c1-6-13(14)8-7-11(4)15-9-12(5)16-10(2)3/h6-8,10,12,15H,1,9,14H2,2-5H3/b11-7+,13-8+ |
| InChIKey | MKOSEVFBHYQTLW-ZHSLHGDYSA-N |
| XLogP | 2.32 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|