C11H20N2O2 — CID 89073989
2-[[(2E,4E)-5-aminohepta-2,4,6-trien-2-yl]-(2-hydroxyethyl)amino]ethanol (PubChem CID 89073989) has the molecular formula C11H20N2O2 and a molecular weight of 212.29 g/mol. Its IUPAC name is 2-[[(2E,4E)-5-aminohepta-2,4,6-trien-2-yl]-(2-hydroxyethyl)amino]ethanol.
| Compound Name | 2-[[(2E,4E)-5-aminohepta-2,4,6-trien-2-yl]-(2-hydroxyethyl)amino]ethanol |
|---|---|
| PubChem CID | 89073989 |
| Molecular Formula | C11H20N2O2 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.15 |
| IUPAC Name | 2-[[(2E,4E)-5-aminohepta-2,4,6-trien-2-yl]-(2-hydroxyethyl)amino]ethanol |
| SMILES | C=C/C(N)=C\C=C(/C)N(CCO)CCO |
| InChI | InChI=1S/C11H20N2O2/c1-3-11(12)5-4-10(2)13(6-8-14)7-9-15/h3-5,14-15H,1,6-9,12H2,2H3/b10-4+,11-5+ |
| InChIKey | HDBPJMBBMUVCPC-ZVSIBQGLSA-N |
| XLogP | 0.21 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|