About (4-aminocyclohexa-1,5-dien-1-yl)methanol
(4-aminocyclohexa-1,5-dien-1-yl)methanol (PubChem CID 89073993) has the molecular formula C7H11NO
and a molecular weight of 125.17 g/mol. Its IUPAC name is (4-aminocyclohexa-1,5-dien-1-yl)methanol.
Molecular Properties
| Compound Name | (4-aminocyclohexa-1,5-dien-1-yl)methanol |
| PubChem CID | 89073993 |
| Molecular Formula | C7H11NO |
| Molecular Weight | 125.17 g/mol |
| Exact Mass | 125.08 |
| IUPAC Name | (4-aminocyclohexa-1,5-dien-1-yl)methanol |
| SMILES | NC1C=CC(CO)=CC1 |
| InChI | InChI=1S/C7H11NO/c8-7-3-1-6(5-9)2-4-7/h1-3,7,9H,4-5,8H2 |
| InChIKey | OYPVDQPFFSURFG-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.17 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4-aminocyclohexa-1,5-dien-1-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-aminocyclohexa-1,5-dien-1-yl)methanol?
The IUPAC name of (4-aminocyclohexa-1,5-dien-1-yl)methanol (CID 89073993) is (4-aminocyclohexa-1,5-dien-1-yl)methanol.
What is the SMILES notation for (4-aminocyclohexa-1,5-dien-1-yl)methanol?
The canonical SMILES for (4-aminocyclohexa-1,5-dien-1-yl)methanol is NC1C=CC(CO)=CC1.
What is the InChIKey of (4-aminocyclohexa-1,5-dien-1-yl)methanol?
The InChIKey is OYPVDQPFFSURFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO/c8-7-3-1-6(5-9)2-4-7/h1-3,7,9H,4-5,8H2.
What are the key properties of (4-aminocyclohexa-1,5-dien-1-yl)methanol?
(4-aminocyclohexa-1,5-dien-1-yl)methanol has a molecular weight of 125.17 g/mol, XLogP of 0.19, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-aminocyclohexa-1,5-dien-1-yl)methanol is sourced from PubChem (CID 89073993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).