About N-[4-(3-fluoro-2,6-dimethylmorpholin-4-yl)cyclohexa-1,5-dien-1-yl]formamide
N-[4-(3-fluoro-2,6-dimethylmorpholin-4-yl)cyclohexa-1,5-dien-1-yl]formamide (PubChem CID 89073996) has the molecular formula C13H19FN2O2
and a molecular weight of 254.31 g/mol. Its IUPAC name is N-[4-(3-fluoro-2,6-dimethylmorpholin-4-yl)cyclohexa-1,5-dien-1-yl]formamide.
Molecular Properties
| Compound Name | N-[4-(3-fluoro-2,6-dimethylmorpholin-4-yl)cyclohexa-1,5-dien-1-yl]formamide |
| PubChem CID | 89073996 |
| Molecular Formula | C13H19FN2O2 |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.14 |
| IUPAC Name | N-[4-(3-fluoro-2,6-dimethylmorpholin-4-yl)cyclohexa-1,5-dien-1-yl]formamide |
| SMILES | CC1CN(C2C=CC(NC=O)=CC2)C(F)C(C)O1 |
| InChI | InChI=1S/C13H19FN2O2/c1-9-7-16(13(14)10(2)18-9)12-5-3-11(4-6-12)15-8-17/h3-5,8-10,12-13H,6-7H2,1-2H3,(H,15,17) |
| InChIKey | DBIYMINMSVJOHY-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze N-[4-(3-fluoro-2,6-dimethylmorpholin-4-yl)cyclohexa-1,5-dien-1-yl]formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(3-fluoro-2,6-dimethylmorpholin-4-yl)cyclohexa-1,5-dien-1-yl]formamide?
The IUPAC name of N-[4-(3-fluoro-2,6-dimethylmorpholin-4-yl)cyclohexa-1,5-dien-1-yl]formamide (CID 89073996) is N-[4-(3-fluoro-2,6-dimethylmorpholin-4-yl)cyclohexa-1,5-dien-1-yl]formamide.
What is the SMILES notation for N-[4-(3-fluoro-2,6-dimethylmorpholin-4-yl)cyclohexa-1,5-dien-1-yl]formamide?
The canonical SMILES for N-[4-(3-fluoro-2,6-dimethylmorpholin-4-yl)cyclohexa-1,5-dien-1-yl]formamide is CC1CN(C2C=CC(NC=O)=CC2)C(F)C(C)O1.
What is the InChIKey of N-[4-(3-fluoro-2,6-dimethylmorpholin-4-yl)cyclohexa-1,5-dien-1-yl]formamide?
The InChIKey is DBIYMINMSVJOHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19FN2O2/c1-9-7-16(13(14)10(2)18-9)12-5-3-11(4-6-12)15-8-17/h3-5,8-10,12-13H,6-7H2,1-2H3,(H,15,17).
What are the key properties of N-[4-(3-fluoro-2,6-dimethylmorpholin-4-yl)cyclohexa-1,5-dien-1-yl]formamide?
N-[4-(3-fluoro-2,6-dimethylmorpholin-4-yl)cyclohexa-1,5-dien-1-yl]formamide has a molecular weight of 254.31 g/mol, XLogP of 1.35, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(3-fluoro-2,6-dimethylmorpholin-4-yl)cyclohexa-1,5-dien-1-yl]formamide is sourced from PubChem (CID 89073996), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).