C16H30N2O — CID 89073999
(2Z)-2,3-dimethyl-4-(2,3,6-trimethylmorpholin-4-yl)hepta-2,6-dien-1-amine (PubChem CID 89073999) has the molecular formula C16H30N2O and a molecular weight of 266.43 g/mol. Its IUPAC name is (2Z)-2,3-dimethyl-4-(2,3,6-trimethylmorpholin-4-yl)hepta-2,6-dien-1-amine.
| Compound Name | (2Z)-2,3-dimethyl-4-(2,3,6-trimethylmorpholin-4-yl)hepta-2,6-dien-1-amine |
|---|---|
| PubChem CID | 89073999 |
| Molecular Formula | C16H30N2O |
| Molecular Weight | 266.43 g/mol |
| Exact Mass | 266.24 |
| IUPAC Name | (2Z)-2,3-dimethyl-4-(2,3,6-trimethylmorpholin-4-yl)hepta-2,6-dien-1-amine |
| SMILES | C=CCC(/C(C)=C(/C)CN)N1CC(C)OC(C)C1C |
| InChI | InChI=1S/C16H30N2O/c1-7-8-16(13(4)11(2)9-17)18-10-12(3)19-15(6)14(18)5/h7,12,14-16H,1,8-10,17H2,2-6H3/b13-11- |
| InChIKey | QRLKJQQURVYASO-QBFSEMIESA-N |
| XLogP | 2.72 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.43 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|