About N-(4-butylcyclohexa-1,5-dien-1-yl)formamide
N-(4-butylcyclohexa-1,5-dien-1-yl)formamide (PubChem CID 89074062) has the molecular formula C11H17NO
and a molecular weight of 179.26 g/mol. Its IUPAC name is N-(4-butylcyclohexa-1,5-dien-1-yl)formamide.
Molecular Properties
| Compound Name | N-(4-butylcyclohexa-1,5-dien-1-yl)formamide |
| PubChem CID | 89074062 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | N-(4-butylcyclohexa-1,5-dien-1-yl)formamide |
| SMILES | CCCCC1C=CC(NC=O)=CC1 |
| InChI | InChI=1S/C11H17NO/c1-2-3-4-10-5-7-11(8-6-10)12-9-13/h5,7-10H,2-4,6H2,1H3,(H,12,13) |
| InChIKey | RERSLINNVSYTSW-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-(4-butylcyclohexa-1,5-dien-1-yl)formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-butylcyclohexa-1,5-dien-1-yl)formamide?
The IUPAC name of N-(4-butylcyclohexa-1,5-dien-1-yl)formamide (CID 89074062) is N-(4-butylcyclohexa-1,5-dien-1-yl)formamide.
What is the SMILES notation for N-(4-butylcyclohexa-1,5-dien-1-yl)formamide?
The canonical SMILES for N-(4-butylcyclohexa-1,5-dien-1-yl)formamide is CCCCC1C=CC(NC=O)=CC1.
What is the InChIKey of N-(4-butylcyclohexa-1,5-dien-1-yl)formamide?
The InChIKey is RERSLINNVSYTSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO/c1-2-3-4-10-5-7-11(8-6-10)12-9-13/h5,7-10H,2-4,6H2,1H3,(H,12,13).
What are the key properties of N-(4-butylcyclohexa-1,5-dien-1-yl)formamide?
N-(4-butylcyclohexa-1,5-dien-1-yl)formamide has a molecular weight of 179.26 g/mol, XLogP of 2.38, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-butylcyclohexa-1,5-dien-1-yl)formamide is sourced from PubChem (CID 89074062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).