C19H34N2 — CID 89074096
4-[N-(5,5-diethylheptan-2-yl)-C-methylcarbonimidoyl]cyclohexa-1,5-dien-1-amine (PubChem CID 89074096) has the molecular formula C19H34N2 and a molecular weight of 290.50 g/mol. Its IUPAC name is 4-[N-(5,5-diethylheptan-2-yl)-C-methylcarbonimidoyl]cyclohexa-1,5-dien-1-amine.
| Compound Name | 4-[N-(5,5-diethylheptan-2-yl)-C-methylcarbonimidoyl]cyclohexa-1,5-dien-1-amine |
|---|---|
| PubChem CID | 89074096 |
| Molecular Formula | C19H34N2 |
| Molecular Weight | 290.50 g/mol |
| Exact Mass | 290.27 |
| IUPAC Name | 4-[N-(5,5-diethylheptan-2-yl)-C-methylcarbonimidoyl]cyclohexa-1,5-dien-1-amine |
| SMILES | CCC(CC)(CC)CCC(C)/N=C(\C)C1C=CC(N)=CC1 |
| InChI | InChI=1S/C19H34N2/c1-6-19(7-2,8-3)14-13-15(4)21-16(5)17-9-11-18(20)12-10-17/h9,11-12,15,17H,6-8,10,13-14,20H2,1-5H3/b21-16+ |
| InChIKey | PUNGYZBJPYFTME-LTGZKZEYSA-N |
| XLogP | 5.25 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.50 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|