About 4,5-dimethoxycyclohexa-1,3-dien-1-amine
4,5-dimethoxycyclohexa-1,3-dien-1-amine (PubChem CID 89074124) has the molecular formula C8H13NO2
and a molecular weight of 155.20 g/mol. Its IUPAC name is 4,5-dimethoxycyclohexa-1,3-dien-1-amine.
Molecular Properties
| Compound Name | 4,5-dimethoxycyclohexa-1,3-dien-1-amine |
| PubChem CID | 89074124 |
| Molecular Formula | C8H13NO2 |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.09 |
| IUPAC Name | 4,5-dimethoxycyclohexa-1,3-dien-1-amine |
| SMILES | COC1=CC=C(N)CC1OC |
| InChI | InChI=1S/C8H13NO2/c1-10-7-4-3-6(9)5-8(7)11-2/h3-4,8H,5,9H2,1-2H3 |
| InChIKey | VEEWIJRYUQTZMV-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4,5-dimethoxycyclohexa-1,3-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dimethoxycyclohexa-1,3-dien-1-amine?
The IUPAC name of 4,5-dimethoxycyclohexa-1,3-dien-1-amine (CID 89074124) is 4,5-dimethoxycyclohexa-1,3-dien-1-amine.
What is the SMILES notation for 4,5-dimethoxycyclohexa-1,3-dien-1-amine?
The canonical SMILES for 4,5-dimethoxycyclohexa-1,3-dien-1-amine is COC1=CC=C(N)CC1OC.
What is the InChIKey of 4,5-dimethoxycyclohexa-1,3-dien-1-amine?
The InChIKey is VEEWIJRYUQTZMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO2/c1-10-7-4-3-6(9)5-8(7)11-2/h3-4,8H,5,9H2,1-2H3.
What are the key properties of 4,5-dimethoxycyclohexa-1,3-dien-1-amine?
4,5-dimethoxycyclohexa-1,3-dien-1-amine has a molecular weight of 155.20 g/mol, XLogP of 0.78, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dimethoxycyclohexa-1,3-dien-1-amine is sourced from PubChem (CID 89074124), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).