C12H19NO — CID 89074125
(3E,5Z)-4-cyclopentyloxyhepta-1,3,5-trien-2-amine (PubChem CID 89074125) has the molecular formula C12H19NO and a molecular weight of 193.29 g/mol. Its IUPAC name is (3E,5Z)-4-cyclopentyloxyhepta-1,3,5-trien-2-amine.
| Compound Name | (3E,5Z)-4-cyclopentyloxyhepta-1,3,5-trien-2-amine |
|---|---|
| PubChem CID | 89074125 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | (3E,5Z)-4-cyclopentyloxyhepta-1,3,5-trien-2-amine |
| SMILES | C=C(N)/C=C(\C=C/C)OC1CCCC1 |
| InChI | InChI=1S/C12H19NO/c1-3-6-12(9-10(2)13)14-11-7-4-5-8-11/h3,6,9,11H,2,4-5,7-8,13H2,1H3/b6-3-,12-9+ |
| InChIKey | VTRQSLQNNXPMLA-GPIRXWPPSA-N |
| XLogP | 2.88 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|